C14H24ClNO — CID 69349289
3-[(2R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride (PubChem CID 69349289) has the molecular formula C14H24ClNO and a molecular weight of 257.81 g/mol. Its IUPAC name is 3-[(2R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride.
| Compound Name | 3-[(2R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 69349289 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3-[(2R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;hydrochloride |
| SMILES | CCC(c1cccc(O)c1)[C@@H](C)CN(C)C.Cl |
| InChI | InChI=1S/C14H23NO.ClH/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12;/h6-9,11,14,16H,5,10H2,1-4H3;1H/t11-,14?;/m0./s1 |
| InChIKey | ZELFLGGRLLOERW-ZWUXEHSLSA-N |
| XLogP | 3.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |