C15H25NO — CID 78358059
(3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine (PubChem CID 78358059) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine.
| Compound Name | (3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 78358059 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentan-1-amine |
| SMILES | CC[C@@H](c1cccc(OC)c1)C(C)CN(C)C |
| InChI | InChI=1S/C15H25NO/c1-6-15(12(2)11-16(3)4)13-8-7-9-14(10-13)17-5/h7-10,12,15H,6,11H2,1-5H3/t12?,15-/m1/s1 |
| InChIKey | JKVBTSJLQLSTHJ-WPZCJLIBSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |