C17H28N2O3 — CID 50899289
[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] N-methoxy-N-methylcarbamate (PubChem CID 50899289) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] N-methoxy-N-methylcarbamate.
| Compound Name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] N-methoxy-N-methylcarbamate |
|---|---|
| PubChem CID | 50899289 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] N-methoxy-N-methylcarbamate |
| SMILES | CC[C@@H](c1cccc(OC(=O)N(C)OC)c1)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C17H28N2O3/c1-7-16(13(2)12-18(3)4)14-9-8-10-15(11-14)22-17(20)19(5)21-6/h8-11,13,16H,7,12H2,1-6H3/t13-,16+/m0/s1 |
| InChIKey | UBRSNXQBMWKBTL-XJKSGUPXSA-N |
| XLogP | 3.37 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|