C23H36N2O4 — CID 54760738
[3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 1-(aminomethyl)cyclohexane-1-carboxylate (PubChem CID 54760738) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 1-(aminomethyl)cyclohexane-1-carboxylate.
| Compound Name | [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 1-(aminomethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54760738 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 1-(aminomethyl)cyclohexane-1-carboxylate |
| SMILES | CCC(c1cccc(OC(=O)OC(=O)C2(CN)CCCCC2)c1)C(C)CN(C)C |
| InChI | InChI=1S/C23H36N2O4/c1-5-20(17(2)15-25(3)4)18-10-9-11-19(14-18)28-22(27)29-21(26)23(16-24)12-7-6-8-13-23/h9-11,14,17,20H,5-8,12-13,15-16,24H2,1-4H3 |
| InChIKey | RVFKAUDRSXVJAL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|