C21H29NO3S — CID 66553530
[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 66553530) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 66553530 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CC[C@@H](c1cccc(OS(=O)(=O)c2ccc(C)cc2)c1)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C21H29NO3S/c1-6-21(17(3)15-22(4)5)18-8-7-9-19(14-18)25-26(23,24)20-12-10-16(2)11-13-20/h7-14,17,21H,6,15H2,1-5H3/t17-,21+/m0/s1 |
| InChIKey | MOXGKYLEUMLQGC-LAUBAEHRSA-N |
| XLogP | 4.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|