C21H28O4S — CID 87378112
[2-ethyl-3-(3-methoxyphenyl)pentyl] 4-methylbenzenesulfonate (PubChem CID 87378112) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is [2-ethyl-3-(3-methoxyphenyl)pentyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethyl-3-(3-methoxyphenyl)pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87378112 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [2-ethyl-3-(3-methoxyphenyl)pentyl] 4-methylbenzenesulfonate |
| SMILES | CCC(COS(=O)(=O)c1ccc(C)cc1)C(CC)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H28O4S/c1-5-17(21(6-2)18-8-7-9-19(14-18)24-4)15-25-26(22,23)20-12-10-16(3)11-13-20/h7-14,17,21H,5-6,15H2,1-4H3 |
| InChIKey | FXRJFFLXQUEEGO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|