C16H16NO3S+ — CID 170922892
[(3-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-methylidyneazanium (PubChem CID 170922892) has the molecular formula C16H16NO3S+ and a molecular weight of 302.38 g/mol. Its IUPAC name is [(3-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-methylidyneazanium.
| Compound Name | [(3-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-methylidyneazanium |
|---|---|
| PubChem CID | 170922892 |
| Molecular Formula | C16H16NO3S+ |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | [(3-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]-methylidyneazanium |
| SMILES | C#[N+]C(c1cccc(OC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H16NO3S/c1-12-7-9-15(10-8-12)21(18,19)16(17-2)13-5-4-6-14(11-13)20-3/h2,4-11,16H,1,3H3/q+1 |
| InChIKey | SNXCMHOCAKABMN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |