C23H24FNO3S — CID 93179193
N-(3-fluoro-4-methylphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 93179193) has the molecular formula C23H24FNO3S and a molecular weight of 413.51 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 93179193 |
| Molecular Formula | C23H24FNO3S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cccc([C@H](C)N(c2ccc(C)c(F)c2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H24FNO3S/c1-16-8-12-22(13-9-16)29(26,27)25(20-11-10-17(2)23(24)15-20)18(3)19-6-5-7-21(14-19)28-4/h5-15,18H,1-4H3/t18-/m0/s1 |
| InChIKey | IXIVPIJVGUGVAR-SFHVURJKSA-N |
| XLogP | 5.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |