C23H25NO4S — CID 93179170
4-methoxy-N-(3-methoxyphenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide (PubChem CID 93179170) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-methoxy-N-(3-methoxyphenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-(3-methoxyphenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 93179170 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-methoxy-N-(3-methoxyphenyl)-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(c2cccc(OC)c2)[C@@H](C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H25NO4S/c1-17-8-10-19(11-9-17)18(2)24(20-6-5-7-22(16-20)28-4)29(25,26)23-14-12-21(27-3)13-15-23/h5-16,18H,1-4H3/t18-/m0/s1 |
| InChIKey | BJFKZCDXPHSESB-SFHVURJKSA-N |
| XLogP | 4.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |