C23H25NO3S — CID 46021631
N-(3-methoxyphenyl)-4-methyl-N-[1-(2-methylphenyl)ethyl]benzenesulfonamide (PubChem CID 46021631) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-methyl-N-[1-(2-methylphenyl)ethyl]benzenesulfonamide.
| Compound Name | N-(3-methoxyphenyl)-4-methyl-N-[1-(2-methylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46021631 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(3-methoxyphenyl)-4-methyl-N-[1-(2-methylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1cccc(N(C(C)c2ccccc2C)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H25NO3S/c1-17-12-14-22(15-13-17)28(25,26)24(20-9-7-10-21(16-20)27-4)19(3)23-11-6-5-8-18(23)2/h5-16,19H,1-4H3 |
| InChIKey | MCCCRNMNOJFMIZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |