C22H22FNO2S — CID 93207182
N-[(1S)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 93207182) has the molecular formula C22H22FNO2S and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(1S)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | N-[(1S)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 93207182 |
| Molecular Formula | C22H22FNO2S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(1S)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2cccc(C)c2)[C@@H](C)c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H22FNO2S/c1-16-11-13-20(14-12-16)27(25,26)24(19-8-6-7-17(2)15-19)18(3)21-9-4-5-10-22(21)23/h4-15,18H,1-3H3/t18-/m0/s1 |
| InChIKey | JJHIULKHOFCISW-SFHVURJKSA-N |
| XLogP | 5.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |