C21H20FNO2S — CID 42841653
N-[1-(2-fluorophenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 42841653) has the molecular formula C21H20FNO2S and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42841653 |
| Molecular Formula | C21H20FNO2S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(N(C(C)c2ccccc2F)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H20FNO2S/c1-16-9-8-10-18(15-16)23(17(2)20-13-6-7-14-21(20)22)26(24,25)19-11-4-3-5-12-19/h3-15,17H,1-2H3 |
| InChIKey | VYSLJVMVRTVLBI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |