C20H16ClF2NO2S — CID 93207173
4-chloro-N-(4-fluorophenyl)-N-[(1R)-1-(2-fluorophenyl)ethyl]benzenesulfonamide (PubChem CID 93207173) has the molecular formula C20H16ClF2NO2S and a molecular weight of 407.87 g/mol. Its IUPAC name is 4-chloro-N-(4-fluorophenyl)-N-[(1R)-1-(2-fluorophenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(4-fluorophenyl)-N-[(1R)-1-(2-fluorophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 93207173 |
| Molecular Formula | C20H16ClF2NO2S |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 4-chloro-N-(4-fluorophenyl)-N-[(1R)-1-(2-fluorophenyl)ethyl]benzenesulfonamide |
| SMILES | C[C@H](c1ccccc1F)N(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16ClF2NO2S/c1-14(19-4-2-3-5-20(19)23)24(17-10-8-16(22)9-11-17)27(25,26)18-12-6-15(21)7-13-18/h2-14H,1H3/t14-/m1/s1 |
| InChIKey | BXGZVNNGSHHVBP-CQSZACIVSA-N |
| XLogP | 5.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |