C22H21ClFNO2S — CID 93207668
3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 93207668) has the molecular formula C22H21ClFNO2S and a molecular weight of 417.93 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 93207668 |
| Molecular Formula | C22H21ClFNO2S |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-chloro-N-[(1R)-1-(2-fluorophenyl)ethyl]-4-methyl-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(N([C@H](C)c2ccccc2F)S(=O)(=O)c2ccc(C)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H21ClFNO2S/c1-15-7-6-8-18(13-15)25(17(3)20-9-4-5-10-22(20)24)28(26,27)19-12-11-16(2)21(23)14-19/h4-14,17H,1-3H3/t17-/m1/s1 |
| InChIKey | SDALWQAQGMUVNW-QGZVFWFLSA-N |
| XLogP | 6.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |