C21H18ClF2NO2S — CID 42842020
3-chloro-N-(4-fluorophenyl)-N-[1-(2-fluorophenyl)ethyl]-2-methylbenzenesulfonamide (PubChem CID 42842020) has the molecular formula C21H18ClF2NO2S and a molecular weight of 421.90 g/mol. Its IUPAC name is 3-chloro-N-(4-fluorophenyl)-N-[1-(2-fluorophenyl)ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-(4-fluorophenyl)-N-[1-(2-fluorophenyl)ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 42842020 |
| Molecular Formula | C21H18ClF2NO2S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3-chloro-N-(4-fluorophenyl)-N-[1-(2-fluorophenyl)ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N(c1ccc(F)cc1)C(C)c1ccccc1F |
| InChI | InChI=1S/C21H18ClF2NO2S/c1-14-19(22)7-5-9-21(14)28(26,27)25(17-12-10-16(23)11-13-17)15(2)18-6-3-4-8-20(18)24/h3-13,15H,1-2H3 |
| InChIKey | CDCZWNMRFVOHSQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |