C21H19ClFNO2S — CID 93147758
N-[(1R)-1-(4-chlorophenyl)ethyl]-3-fluoro-4-methyl-N-phenylbenzenesulfonamide (PubChem CID 93147758) has the molecular formula C21H19ClFNO2S and a molecular weight of 403.91 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-3-fluoro-4-methyl-N-phenylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-3-fluoro-4-methyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 93147758 |
| Molecular Formula | C21H19ClFNO2S |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-3-fluoro-4-methyl-N-phenylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccccc2)[C@H](C)c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C21H19ClFNO2S/c1-15-8-13-20(14-21(15)23)27(25,26)24(19-6-4-3-5-7-19)16(2)17-9-11-18(22)12-10-17/h3-14,16H,1-2H3/t16-/m1/s1 |
| InChIKey | CEAMRPWXWJOINW-MRXNPFEDSA-N |
| XLogP | 5.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |