C22H22FNO3S — CID 93207219
4-fluoro-N-[(1R)-1-(3-methoxyphenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 93207219) has the molecular formula C22H22FNO3S and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-fluoro-N-[(1R)-1-(3-methoxyphenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(1R)-1-(3-methoxyphenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 93207219 |
| Molecular Formula | C22H22FNO3S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-fluoro-N-[(1R)-1-(3-methoxyphenyl)ethyl]-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | COc1cccc([C@@H](C)N(c2cccc(C)c2)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H22FNO3S/c1-16-6-4-8-20(14-16)24(17(2)18-7-5-9-21(15-18)27-3)28(25,26)22-12-10-19(23)11-13-22/h4-15,17H,1-3H3/t17-/m1/s1 |
| InChIKey | ORGTUBIYUQUTBH-QGZVFWFLSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |