C22H22FNO4S — CID 46022772
N-(3-fluorophenyl)-4-methoxy-N-[1-(2-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 46022772) has the molecular formula C22H22FNO4S and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-methoxy-N-[1-(2-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | N-(3-fluorophenyl)-4-methoxy-N-[1-(2-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46022772 |
| Molecular Formula | C22H22FNO4S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-(3-fluorophenyl)-4-methoxy-N-[1-(2-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(c2cccc(F)c2)C(C)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C22H22FNO4S/c1-16(21-9-4-5-10-22(21)28-3)24(18-8-6-7-17(23)15-18)29(25,26)20-13-11-19(27-2)12-14-20/h4-16H,1-3H3 |
| InChIKey | JDLPHETYQDIKBR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |