C24H38N2O4 — CID 56849135
[3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 2-[1-(aminomethyl)cyclohexyl]acetate (PubChem CID 56849135) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 2-[1-(aminomethyl)cyclohexyl]acetate.
| Compound Name | [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 2-[1-(aminomethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 56849135 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenoxy]carbonyl 2-[1-(aminomethyl)cyclohexyl]acetate |
| SMILES | CCC(c1cccc(OC(=O)OC(=O)CC2(CN)CCCCC2)c1)C(C)CN(C)C |
| InChI | InChI=1S/C24H38N2O4/c1-5-21(18(2)16-26(3)4)19-10-9-11-20(14-19)29-23(28)30-22(27)15-24(17-25)12-7-6-8-13-24/h9-11,14,18,21H,5-8,12-13,15-17,25H2,1-4H3 |
| InChIKey | VLYKDWHZBTZWGJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|