C21H33NO2 — CID 175786067
[2,3-di(propan-2-yl)phenyl] 2-[1-(aminomethyl)cyclohexyl]acetate (PubChem CID 175786067) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is [2,3-di(propan-2-yl)phenyl] 2-[1-(aminomethyl)cyclohexyl]acetate.
| Compound Name | [2,3-di(propan-2-yl)phenyl] 2-[1-(aminomethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 175786067 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | [2,3-di(propan-2-yl)phenyl] 2-[1-(aminomethyl)cyclohexyl]acetate |
| SMILES | CC(C)c1cccc(OC(=O)CC2(CN)CCCCC2)c1C(C)C |
| InChI | InChI=1S/C21H33NO2/c1-15(2)17-9-8-10-18(20(17)16(3)4)24-19(23)13-21(14-22)11-6-5-7-12-21/h8-10,15-16H,5-7,11-14,22H2,1-4H3 |
| InChIKey | VMHQDWSUIPSWTO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|