C15H26NO+ — CID 86313247
[(2R,3R)-3-(3-methoxyphenyl)-2-methylpentyl]-dimethylazanium (PubChem CID 86313247) has the molecular formula C15H26NO+ and a molecular weight of 236.38 g/mol. Its IUPAC name is [(2R,3R)-3-(3-methoxyphenyl)-2-methylpentyl]-dimethylazanium.
| Compound Name | [(2R,3R)-3-(3-methoxyphenyl)-2-methylpentyl]-dimethylazanium |
|---|---|
| PubChem CID | 86313247 |
| Molecular Formula | C15H26NO+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [(2R,3R)-3-(3-methoxyphenyl)-2-methylpentyl]-dimethylazanium |
| SMILES | CC[C@@H](c1cccc(OC)c1)[C@@H](C)C[NH+](C)C |
| InChI | InChI=1S/C15H25NO/c1-6-15(12(2)11-16(3)4)13-8-7-9-14(10-13)17-5/h7-10,12,15H,6,11H2,1-5H3/p+1/t12-,15+/m0/s1 |
| InChIKey | JKVBTSJLQLSTHJ-SWLSCSKDSA-O |
| XLogP | 1.97 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |