C15H23NO2 — CID 58555143
(2S,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentanamide (PubChem CID 58555143) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2S,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentanamide.
| Compound Name | (2S,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentanamide |
|---|---|
| PubChem CID | 58555143 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2S,3R)-3-(3-methoxyphenyl)-N,N,2-trimethylpentanamide |
| SMILES | CC[C@@H](c1cccc(OC)c1)[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C15H23NO2/c1-6-14(11(2)15(17)16(3)4)12-8-7-9-13(10-12)18-5/h7-11,14H,6H2,1-5H3/t11-,14+/m0/s1 |
| InChIKey | NEGIXZFBTSZPII-SMDDNHRTSA-N |
| XLogP | 2.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |