C13H19NO3 — CID 46778420
2-(3-methoxyphenoxy)-N,N-dimethylbutanamide (PubChem CID 46778420) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-N,N-dimethylbutanamide.
| Compound Name | 2-(3-methoxyphenoxy)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 46778420 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(3-methoxyphenoxy)-N,N-dimethylbutanamide |
| SMILES | CCC(Oc1cccc(OC)c1)C(=O)N(C)C |
| InChI | InChI=1S/C13H19NO3/c1-5-12(13(15)14(2)3)17-11-8-6-7-10(9-11)16-4/h6-9,12H,5H2,1-4H3 |
| InChIKey | YHWAFLSOVMCXDO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |