C12H17NO3 — CID 140960898
(3S)-4-hydroxy-3-(3-methoxyphenyl)-2-methylbutanamide (PubChem CID 140960898) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3S)-4-hydroxy-3-(3-methoxyphenyl)-2-methylbutanamide.
| Compound Name | (3S)-4-hydroxy-3-(3-methoxyphenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 140960898 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3S)-4-hydroxy-3-(3-methoxyphenyl)-2-methylbutanamide |
| SMILES | COc1cccc([C@@H](CO)C(C)C(N)=O)c1 |
| InChI | InChI=1S/C12H17NO3/c1-8(12(13)15)11(7-14)9-4-3-5-10(6-9)16-2/h3-6,8,11,14H,7H2,1-2H3,(H2,13,15)/t8?,11-/m0/s1 |
| InChIKey | GMQLUVLUTZYQNJ-LYNSQETBSA-N |
| XLogP | 0.89 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |