C16H25NO4 — CID 125466926
ethyl (2R,3S)-3-(3-hydroxypropylamino)-2-(3-methoxyphenyl)butanoate (PubChem CID 125466926) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(3-hydroxypropylamino)-2-(3-methoxyphenyl)butanoate.
| Compound Name | ethyl (2R,3S)-3-(3-hydroxypropylamino)-2-(3-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 125466926 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethyl (2R,3S)-3-(3-hydroxypropylamino)-2-(3-methoxyphenyl)butanoate |
| SMILES | CCOC(=O)[C@H](c1cccc(OC)c1)[C@H](C)NCCCO |
| InChI | InChI=1S/C16H25NO4/c1-4-21-16(19)15(12(2)17-9-6-10-18)13-7-5-8-14(11-13)20-3/h5,7-8,11-12,15,17-18H,4,6,9-10H2,1-3H3/t12-,15-/m0/s1 |
| InChIKey | VXONSIRMCWCPQC-WFASDCNBSA-N |
| XLogP | 1.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|