C33H43NO3 — CID 161278873
3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;(2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enal (PubChem CID 161278873) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is 3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;(2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enal.
| Compound Name | 3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;(2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enal |
|---|---|
| PubChem CID | 161278873 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol;(2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enal |
| SMILES | C=C[C@@H](c1cccc(OCc2ccccc2)c1)[C@@H](C)C=O.CC[C@@H](c1cccc(O)c1)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C19H20O2.C14H23NO/c1-3-19(15(2)13-20)17-10-7-11-18(12-17)21-14-16-8-5-4-6-9-16;1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12/h3-13,15,19H,1,14H2,2H3;6-9,11,14,16H,5,10H2,1-4H3/t15-,19+;11-,14+/m00/s1 |
| InChIKey | VEURCFPOHAAIBG-RCHAFEGYSA-N |
| XLogP | 7.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|