C20H26O4S — CID 72670222
[2-methyl-3-(3-phenylmethoxyphenyl)pentyl] methanesulfonate (PubChem CID 72670222) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is [2-methyl-3-(3-phenylmethoxyphenyl)pentyl] methanesulfonate.
| Compound Name | [2-methyl-3-(3-phenylmethoxyphenyl)pentyl] methanesulfonate |
|---|---|
| PubChem CID | 72670222 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-methyl-3-(3-phenylmethoxyphenyl)pentyl] methanesulfonate |
| SMILES | CCC(c1cccc(OCc2ccccc2)c1)C(C)COS(C)(=O)=O |
| InChI | InChI=1S/C20H26O4S/c1-4-20(16(2)14-24-25(3,21)22)18-11-8-12-19(13-18)23-15-17-9-6-5-7-10-17/h5-13,16,20H,4,14-15H2,1-3H3 |
| InChIKey | XISZOYMWMSNEAM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|