C16H19O4P — CID 172834538
[(2S)-2-(3-phenylmethoxyphenyl)propyl]phosphonic acid (PubChem CID 172834538) has the molecular formula C16H19O4P and a molecular weight of 306.30 g/mol. Its IUPAC name is [(2S)-2-(3-phenylmethoxyphenyl)propyl]phosphonic acid.
| Compound Name | [(2S)-2-(3-phenylmethoxyphenyl)propyl]phosphonic acid |
|---|---|
| PubChem CID | 172834538 |
| Molecular Formula | C16H19O4P |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [(2S)-2-(3-phenylmethoxyphenyl)propyl]phosphonic acid |
| SMILES | C[C@H](CP(=O)(O)O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C16H19O4P/c1-13(12-21(17,18)19)15-8-5-9-16(10-15)20-11-14-6-3-2-4-7-14/h2-10,13H,11-12H2,1H3,(H2,17,18,19)/t13-/m1/s1 |
| InChIKey | VYYSAYHDDOSDGG-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|