C19H20O3 — CID 71623405
(2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enoic acid (PubChem CID 71623405) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enoic acid.
| Compound Name | (2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 71623405 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2R,3R)-2-methyl-3-(3-phenylmethoxyphenyl)pent-4-enoic acid |
| SMILES | C=C[C@@H](c1cccc(OCc2ccccc2)c1)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H20O3/c1-3-18(14(2)19(20)21)16-10-7-11-17(12-16)22-13-15-8-5-4-6-9-15/h3-12,14,18H,1,13H2,2H3,(H,20,21)/t14-,18-/m1/s1 |
| InChIKey | UNJLYNWSIVCMMQ-RDTXWAMCSA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|