C20H26O2 — CID 21288530
2-methyl-1-(3-phenylmethoxyphenyl)hexan-1-ol (PubChem CID 21288530) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-methyl-1-(3-phenylmethoxyphenyl)hexan-1-ol.
| Compound Name | 2-methyl-1-(3-phenylmethoxyphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 21288530 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-methyl-1-(3-phenylmethoxyphenyl)hexan-1-ol |
| SMILES | CCCCC(C)C(O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H26O2/c1-3-4-9-16(2)20(21)18-12-8-13-19(14-18)22-15-17-10-6-5-7-11-17/h5-8,10-14,16,20-21H,3-4,9,15H2,1-2H3 |
| InChIKey | ICYFKBPUPGCURX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |