C18H31NO2 — CID 118334144
(1S,2R)-3-amino-2-methyl-1-[3-(2-propylpentoxy)phenyl]propan-1-ol (PubChem CID 118334144) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (1S,2R)-3-amino-2-methyl-1-[3-(2-propylpentoxy)phenyl]propan-1-ol.
| Compound Name | (1S,2R)-3-amino-2-methyl-1-[3-(2-propylpentoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 118334144 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (1S,2R)-3-amino-2-methyl-1-[3-(2-propylpentoxy)phenyl]propan-1-ol |
| SMILES | CCCC(CCC)COc1cccc([C@@H](O)[C@H](C)CN)c1 |
| InChI | InChI=1S/C18H31NO2/c1-4-7-15(8-5-2)13-21-17-10-6-9-16(11-17)18(20)14(3)12-19/h6,9-11,14-15,18,20H,4-5,7-8,12-13,19H2,1-3H3/t14-,18+/m1/s1 |
| InChIKey | AMOUQVURICJPGD-KDOFPFPSSA-N |
| XLogP | 3.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |