C15H25NO — CID 58027597
[3-(2-propylpentoxy)phenyl]methanamine (PubChem CID 58027597) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is [3-(2-propylpentoxy)phenyl]methanamine.
| Compound Name | [3-(2-propylpentoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 58027597 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | [3-(2-propylpentoxy)phenyl]methanamine |
| SMILES | CCCC(CCC)COc1cccc(CN)c1 |
| InChI | InChI=1S/C15H25NO/c1-3-6-13(7-4-2)12-17-15-9-5-8-14(10-15)11-16/h5,8-10,13H,3-4,6-7,11-12,16H2,1-2H3 |
| InChIKey | PMNCDFAEWMHCMA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |