C10H11F4NO — CID 150786633
[3-(2,3,3,3-tetrafluoropropoxy)phenyl]methanamine (PubChem CID 150786633) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is [3-(2,3,3,3-tetrafluoropropoxy)phenyl]methanamine.
| Compound Name | [3-(2,3,3,3-tetrafluoropropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 150786633 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [3-(2,3,3,3-tetrafluoropropoxy)phenyl]methanamine |
| SMILES | NCc1cccc(OCC(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F4NO/c11-9(10(12,13)14)6-16-8-3-1-2-7(4-8)5-15/h1-4,9H,5-6,15H2 |
| InChIKey | KCZKQIKUYDVRGR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |