C12H16F3NO2 — CID 82955995
[3-[2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]methanamine (PubChem CID 82955995) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is [3-[2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]methanamine.
| Compound Name | [3-[2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 82955995 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [3-[2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]methanamine |
| SMILES | NCc1cccc(OCCOCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO2/c13-12(14,15)4-5-17-6-7-18-11-3-1-2-10(8-11)9-16/h1-3,8H,4-7,9,16H2 |
| InChIKey | FMUOTNNKPZFMAD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|