C14H23AsO — CID 87967492
3-(1-dimethylarsanyl-2-methylpentan-3-yl)phenol (PubChem CID 87967492) has the molecular formula C14H23AsO and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-(1-dimethylarsanyl-2-methylpentan-3-yl)phenol.
| Compound Name | 3-(1-dimethylarsanyl-2-methylpentan-3-yl)phenol |
|---|---|
| PubChem CID | 87967492 |
| Molecular Formula | C14H23AsO |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(1-dimethylarsanyl-2-methylpentan-3-yl)phenol |
| SMILES | CCC(c1cccc(O)c1)C(C)C[As](C)C |
| InChI | InChI=1S/C14H23AsO/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(16)9-12/h6-9,11,14,16H,5,10H2,1-4H3 |
| InChIKey | IETFLCCAOPNJGH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|