C16H19O7P — CID 22673972
[4-hydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate (PubChem CID 22673972) has the molecular formula C16H19O7P and a molecular weight of 354.30 g/mol. Its IUPAC name is [4-hydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-hydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22673972 |
| Molecular Formula | C16H19O7P |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [4-hydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)butyl]phenyl] dihydrogen phosphate |
| SMILES | CCC(c1cccc(O)c1)C(O)c1cc(O)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C16H19O7P/c1-2-13(10-4-3-5-11(17)8-10)16(19)14-9-12(18)6-7-15(14)23-24(20,21)22/h3-9,13,16-19H,2H2,1H3,(H2,20,21,22) |
| InChIKey | QMRUGYDQMDIQSB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|