C10H9O5P — CID 153322561
(7-hydroxynaphthalen-1-yl) dihydrogen phosphate (PubChem CID 153322561) has the molecular formula C10H9O5P and a molecular weight of 240.15 g/mol. Its IUPAC name is (7-hydroxynaphthalen-1-yl) dihydrogen phosphate.
| Compound Name | (7-hydroxynaphthalen-1-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 153322561 |
| Molecular Formula | C10H9O5P |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (7-hydroxynaphthalen-1-yl) dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C10H9O5P/c11-8-5-4-7-2-1-3-10(9(7)6-8)15-16(12,13)14/h1-6,11H,(H2,12,13,14) |
| InChIKey | NRWSIKHVFYDKNS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|