C18H13O4P — CID 175921011
benzo[a]anthracen-4-yl dihydrogen phosphate (PubChem CID 175921011) has the molecular formula C18H13O4P and a molecular weight of 324.27 g/mol. Its IUPAC name is benzo[a]anthracen-4-yl dihydrogen phosphate.
| Compound Name | benzo[a]anthracen-4-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 175921011 |
| Molecular Formula | C18H13O4P |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | benzo[a]anthracen-4-yl dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc2c1ccc1cc3ccccc3cc12 |
| InChI | InChI=1S/C18H13O4P/c19-23(20,21)22-18-7-3-6-15-16(18)9-8-14-10-12-4-1-2-5-13(12)11-17(14)15/h1-11H,(H2,19,20,21) |
| InChIKey | UPLGZDHXVLMQBT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|