C26H19O4P — CID 68585112
(2,3-dinaphthalen-2-ylphenyl) dihydrogen phosphate (PubChem CID 68585112) has the molecular formula C26H19O4P and a molecular weight of 426.41 g/mol. Its IUPAC name is (2,3-dinaphthalen-2-ylphenyl) dihydrogen phosphate.
| Compound Name | (2,3-dinaphthalen-2-ylphenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 68585112 |
| Molecular Formula | C26H19O4P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2,3-dinaphthalen-2-ylphenyl) dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc(-c2ccc3ccccc3c2)c1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H19O4P/c27-31(28,29)30-25-11-5-10-24(22-14-12-18-6-1-3-8-20(18)16-22)26(25)23-15-13-19-7-2-4-9-21(19)17-23/h1-17H,(H2,27,28,29) |
| InChIKey | ZFMIGWMYFXDCQI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|