C20H15O5P — CID 15162418
[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] dihydrogen phosphate (PubChem CID 15162418) has the molecular formula C20H15O5P and a molecular weight of 366.31 g/mol. Its IUPAC name is [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] dihydrogen phosphate.
| Compound Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 15162418 |
| Molecular Formula | C20H15O5P |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H15O5P/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)25-26(22,23)24/h1-12,21H,(H2,22,23,24) |
| InChIKey | BLDKDYYMQMICHM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|