C20H16O8P2 — CID 54196807
[2-(1-phosphonooxynaphthalen-2-yl)naphthalen-1-yl] dihydrogen phosphate (PubChem CID 54196807) has the molecular formula C20H16O8P2 and a molecular weight of 446.29 g/mol. Its IUPAC name is [2-(1-phosphonooxynaphthalen-2-yl)naphthalen-1-yl] dihydrogen phosphate.
| Compound Name | [2-(1-phosphonooxynaphthalen-2-yl)naphthalen-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54196807 |
| Molecular Formula | C20H16O8P2 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | [2-(1-phosphonooxynaphthalen-2-yl)naphthalen-1-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1c(-c2ccc3ccccc3c2OP(=O)(O)O)ccc2ccccc12 |
| InChI | InChI=1S/C20H16O8P2/c21-29(22,23)27-19-15-7-3-1-5-13(15)9-11-17(19)18-12-10-14-6-2-4-8-16(14)20(18)28-30(24,25)26/h1-12H,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | PMJTUFVKLROMRG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|