C38H29O5P — CID 174991429
1-[2-(3,5-diphenylphenyl)naphthalen-1-yl]naphthalen-2-ol;phosphoric acid (PubChem CID 174991429) has the molecular formula C38H29O5P and a molecular weight of 596.62 g/mol. Its IUPAC name is 1-[2-(3,5-diphenylphenyl)naphthalen-1-yl]naphthalen-2-ol;phosphoric acid.
| Compound Name | 1-[2-(3,5-diphenylphenyl)naphthalen-1-yl]naphthalen-2-ol;phosphoric acid |
|---|---|
| PubChem CID | 174991429 |
| Molecular Formula | C38H29O5P |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | 1-[2-(3,5-diphenylphenyl)naphthalen-1-yl]naphthalen-2-ol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1ccc2ccccc2c1-c1c(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)ccc2ccccc12 |
| InChI | InChI=1S/C38H26O.H3O4P/c39-36-22-20-29-16-8-10-18-34(29)38(36)37-33-17-9-7-15-28(33)19-21-35(37)32-24-30(26-11-3-1-4-12-26)23-31(25-32)27-13-5-2-6-14-27;1-5(2,3)4/h1-25,39H;(H3,1,2,3,4) |
| InChIKey | FMNQQKBKCRKLQG-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|