C24H23O2P — CID 102399892
1-(2-diethylphosphorylnaphthalen-1-yl)naphthalen-2-ol (PubChem CID 102399892) has the molecular formula C24H23O2P and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-(2-diethylphosphorylnaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | 1-(2-diethylphosphorylnaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 102399892 |
| Molecular Formula | C24H23O2P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-(2-diethylphosphorylnaphthalen-1-yl)naphthalen-2-ol |
| SMILES | CCP(=O)(CC)c1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C24H23O2P/c1-3-27(26,4-2)22-16-14-18-10-6-8-12-20(18)24(22)23-19-11-7-5-9-17(19)13-15-21(23)25/h5-16,25H,3-4H2,1-2H3 |
| InChIKey | PRDOBASTUKPOSV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|