About cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol
cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 70289333) has the molecular formula C22H16N2O4
and a molecular weight of 372.38 g/mol. Its IUPAC name is cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
Molecular Properties
| Compound Name | cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| PubChem CID | 70289333 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | N#CO.N#CO.Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H14O2.2CHNO/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;2*2-1-3/h1-12,21-22H;2*3H |
| InChIKey | KTBZYRMHPNVMJX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The IUPAC name of cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (CID 70289333) is cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
What is the SMILES notation for cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The canonical SMILES for cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol is N#CO.N#CO.Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12.
What is the InChIKey of cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The InChIKey is KTBZYRMHPNVMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O2.2CHNO/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;2*2-1-3/h1-12,21-22H;2*3H.
What are the key properties of cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol has a molecular weight of 372.38 g/mol, XLogP of 4.75, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol is sourced from PubChem (CID 70289333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).