About chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene
chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene (PubChem CID 10785807) has the molecular formula C23H19CrO2-
and a molecular weight of 379.40 g/mol. Its IUPAC name is chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene.
Molecular Properties
| Compound Name | chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene |
| PubChem CID | 10785807 |
| Molecular Formula | C23H19CrO2- |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene |
| SMILES | C=C[CH2-].Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12.[Cr] |
| InChI | InChI=1S/C20H14O2.C3H5.Cr/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-3-2;/h1-12,21-22H;3H,1-2H2;/q;-1; |
| InChIKey | WXGPEQPASLTMMF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene?
The IUPAC name of chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene (CID 10785807) is chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene.
What is the SMILES notation for chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene?
The canonical SMILES for chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene is C=C[CH2-].Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12.[Cr].
What is the InChIKey of chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene?
The InChIKey is WXGPEQPASLTMMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O2.C3H5.Cr/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-3-2;/h1-12,21-22H;3H,1-2H2;/q;-1;.
What are the key properties of chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene?
chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene has a molecular weight of 379.40 g/mol, XLogP of 6.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;prop-1-ene is sourced from PubChem (CID 10785807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).