About 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium
1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium (PubChem CID 174870866) has the molecular formula C27H35NO4P+
and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium |
| PubChem CID | 174870866 |
| Molecular Formula | C27H35NO4P+ |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.O=P(O)(O)O.c1ccc2c(-c3cccc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C20H14.C7H18N.H3O4P/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;1-5-8(4,6-2)7-3;1-5(2,3)4/h1-14H;5-7H2,1-4H3;(H3,1,2,3,4)/q;+1; |
| InChIKey | NTBHPFKYXBNOMT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium?
The IUPAC name of 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium (CID 174870866) is 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium.
What is the SMILES notation for 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium?
The canonical SMILES for 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium is CC[N+](C)(CC)CC.O=P(O)(O)O.c1ccc2c(-c3cccc4ccccc34)cccc2c1.
What is the InChIKey of 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium?
The InChIKey is NTBHPFKYXBNOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14.C7H18N.H3O4P/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;1-5-8(4,6-2)7-3;1-5(2,3)4/h1-14H;5-7H2,1-4H3;(H3,1,2,3,4)/q;+1;.
What are the key properties of 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium?
1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium has a molecular weight of 468.55 g/mol, XLogP of 6.22, 4 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-1-ylnaphthalene;phosphoric acid;triethyl(methyl)azanium is sourced from PubChem (CID 174870866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).