C14H15O7P — CID 22673477
[3-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl] dihydrogen phosphate (PubChem CID 22673477) has the molecular formula C14H15O7P and a molecular weight of 326.24 g/mol. Its IUPAC name is [3-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl] dihydrogen phosphate.
| Compound Name | [3-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22673477 |
| Molecular Formula | C14H15O7P |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | [3-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc(O)c1C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H15O7P/c15-10-6-4-9(5-7-10)8-12(17)14-11(16)2-1-3-13(14)21-22(18,19)20/h1-7,12,15-17H,8H2,(H2,18,19,20) |
| InChIKey | VYNZYUSVNCMCCT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|