C14H15O6PS — CID 22673501
[4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid (PubChem CID 22673501) has the molecular formula C14H15O6PS and a molecular weight of 342.31 g/mol. Its IUPAC name is [4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid.
| Compound Name | [4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid |
|---|---|
| PubChem CID | 22673501 |
| Molecular Formula | C14H15O6PS |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | [4-hydroxy-2-[1-hydroxy-2-(4-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid |
| SMILES | O=P(O)(O)Sc1ccc(O)cc1C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H15O6PS/c15-10-3-1-9(2-4-10)7-13(17)12-8-11(16)5-6-14(12)22-21(18,19)20/h1-6,8,13,15-17H,7H2,(H2,18,19,20) |
| InChIKey | LNAJORIJKRXWAV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|