C14H15O7PS — CID 22673931
[3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid (PubChem CID 22673931) has the molecular formula C14H15O7PS and a molecular weight of 358.31 g/mol. Its IUPAC name is [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid.
| Compound Name | [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid |
|---|---|
| PubChem CID | 22673931 |
| Molecular Formula | C14H15O7PS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)ethyl]phenyl]sulfanylphosphonic acid |
| SMILES | O=P(O)(O)Sc1cc(O)cc(O)c1C(O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C14H15O7PS/c15-9-3-1-2-8(4-9)5-11(17)14-12(18)6-10(16)7-13(14)23-22(19,20)21/h1-4,6-7,11,15-18H,5H2,(H2,19,20,21) |
| InChIKey | DEBAPVAMRBCYSC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|