C16H17O6PS — CID 22673625
[3-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]sulfanylphosphonic acid (PubChem CID 22673625) has the molecular formula C16H17O6PS and a molecular weight of 368.35 g/mol. Its IUPAC name is [3-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]sulfanylphosphonic acid.
| Compound Name | [3-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]sulfanylphosphonic acid |
|---|---|
| PubChem CID | 22673625 |
| Molecular Formula | C16H17O6PS |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [3-hydroxy-2-[3-(3-hydroxyphenyl)butanoyl]phenyl]sulfanylphosphonic acid |
| SMILES | CC(CC(=O)c1c(O)cccc1SP(=O)(O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H17O6PS/c1-10(11-4-2-5-12(17)9-11)8-14(19)16-13(18)6-3-7-15(16)24-23(20,21)22/h2-7,9-10,17-18H,8H2,1H3,(H2,20,21,22) |
| InChIKey | FIDKUNGLIVLHCE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|